C16H17BrN2O4S — CID 55742620
4-(2-amino-2-oxoethoxy)-N-[(4-bromothiophen-2-yl)methyl]-3-methoxy-N-methylbenzamide (PubChem CID 55742620) has the molecular formula C16H17BrN2O4S and a molecular weight of 413.29 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[(4-bromothiophen-2-yl)methyl]-3-methoxy-N-methylbenzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[(4-bromothiophen-2-yl)methyl]-3-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 55742620 |
| Molecular Formula | C16H17BrN2O4S |
| Molecular Weight | 413.29 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[(4-bromothiophen-2-yl)methyl]-3-methoxy-N-methylbenzamide |
| SMILES | COc1cc(C(=O)N(C)Cc2cc(Br)cs2)ccc1OCC(N)=O |
| InChI | InChI=1S/C16H17BrN2O4S/c1-19(7-12-6-11(17)9-24-12)16(21)10-3-4-13(14(5-10)22-2)23-8-15(18)20/h3-6,9H,7-8H2,1-2H3,(H2,18,20) |
| InChIKey | GMGSLLDCRRZAMK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |