C13H10Br2FNOS — CID 47421884
4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzamide (PubChem CID 47421884) has the molecular formula C13H10Br2FNOS and a molecular weight of 407.10 g/mol. Its IUPAC name is 4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzamide.
| Compound Name | 4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 47421884 |
| Molecular Formula | C13H10Br2FNOS |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 404.88 |
| IUPAC Name | 4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H10Br2FNOS/c1-17(6-10-5-9(14)7-19-10)13(18)8-2-3-11(15)12(16)4-8/h2-5,7H,6H2,1H3 |
| InChIKey | WOHCTYSJGDIWOR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |