C14H12BrN3OS — CID 62921447
N-[(4-bromothiophen-2-yl)methyl]-N-methyl-1H-indazole-6-carboxamide (PubChem CID 62921447) has the molecular formula C14H12BrN3OS and a molecular weight of 350.24 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-methyl-1H-indazole-6-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-1H-indazole-6-carboxamide |
|---|---|
| PubChem CID | 62921447 |
| Molecular Formula | C14H12BrN3OS |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-1H-indazole-6-carboxamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C14H12BrN3OS/c1-18(7-12-5-11(15)8-20-12)14(19)9-2-3-10-6-16-17-13(10)4-9/h2-6,8H,7H2,1H3,(H,16,17) |
| InChIKey | IVJUHNXXYFSHMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |