C12H16N2O4 — CID 47210225
N-(2-amino-2-oxoethyl)-3,4-dimethoxy-N-methylbenzamide (PubChem CID 47210225) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3,4-dimethoxy-N-methylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3,4-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 47210225 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3,4-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)CC(N)=O)cc1OC |
| InChI | InChI=1S/C12H16N2O4/c1-14(7-11(13)15)12(16)8-4-5-9(17-2)10(6-8)18-3/h4-6H,7H2,1-3H3,(H2,13,15) |
| InChIKey | OPYDPWBEBNRDOO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |