C14H21NO5 — CID 3340367
N-(2,2-dimethoxyethyl)-3,4-dimethoxy-N-methylbenzamide (PubChem CID 3340367) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3,4-dimethoxy-N-methylbenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3,4-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 3340367 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3,4-dimethoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)CC(OC)OC)cc1OC |
| InChI | InChI=1S/C14H21NO5/c1-15(9-13(19-4)20-5)14(16)10-6-7-11(17-2)12(8-10)18-3/h6-8,13H,9H2,1-5H3 |
| InChIKey | QLMITCBOSQDICY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|