C13H18ClNO3 — CID 169090050
4-(chloromethyl)-N-(2,2-dimethoxyethyl)-N-methylbenzamide (PubChem CID 169090050) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(2,2-dimethoxyethyl)-N-methylbenzamide.
| Compound Name | 4-(chloromethyl)-N-(2,2-dimethoxyethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 169090050 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-(chloromethyl)-N-(2,2-dimethoxyethyl)-N-methylbenzamide |
| SMILES | COC(CN(C)C(=O)c1ccc(CCl)cc1)OC |
| InChI | InChI=1S/C13H18ClNO3/c1-15(9-12(17-2)18-3)13(16)11-6-4-10(8-14)5-7-11/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | TXXUWENGXUONOU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|