C12H15N3O7 — CID 3422148
N-(2,2-dimethoxyethyl)-N-methyl-3,5-dinitrobenzamide (PubChem CID 3422148) has the molecular formula C12H15N3O7 and a molecular weight of 313.27 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-methyl-3,5-dinitrobenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3422148 |
| Molecular Formula | C12H15N3O7 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-methyl-3,5-dinitrobenzamide |
| SMILES | COC(CN(C)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)OC |
| InChI | InChI=1S/C12H15N3O7/c1-13(7-11(21-2)22-3)12(16)8-4-9(14(17)18)6-10(5-8)15(19)20/h4-6,11H,7H2,1-3H3 |
| InChIKey | AATAJTKBGMFEHM-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|