C13H17FN2O3 — CID 103297123
2-fluoro-N,3-dimethyl-N-(2-methylpropyl)-5-nitrobenzamide (PubChem CID 103297123) has the molecular formula C13H17FN2O3 and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-fluoro-N,3-dimethyl-N-(2-methylpropyl)-5-nitrobenzamide.
| Compound Name | 2-fluoro-N,3-dimethyl-N-(2-methylpropyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 103297123 |
| Molecular Formula | C13H17FN2O3 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-fluoro-N,3-dimethyl-N-(2-methylpropyl)-5-nitrobenzamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(=O)N(C)CC(C)C)c1F |
| InChI | InChI=1S/C13H17FN2O3/c1-8(2)7-15(4)13(17)11-6-10(16(18)19)5-9(3)12(11)14/h5-6,8H,7H2,1-4H3 |
| InChIKey | DOQXRSHADIJKNB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|