C11H13FN2O3 — CID 103297115
N-ethyl-2-fluoro-N,3-dimethyl-5-nitrobenzamide (PubChem CID 103297115) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is N-ethyl-2-fluoro-N,3-dimethyl-5-nitrobenzamide.
| Compound Name | N-ethyl-2-fluoro-N,3-dimethyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 103297115 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-ethyl-2-fluoro-N,3-dimethyl-5-nitrobenzamide |
| SMILES | CCN(C)C(=O)c1cc([N+](=O)[O-])cc(C)c1F |
| InChI | InChI=1S/C11H13FN2O3/c1-4-13(3)11(15)9-6-8(14(16)17)5-7(2)10(9)12/h5-6H,4H2,1-3H3 |
| InChIKey | VZOPDGNTMDSBOY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|