C12H13N3O6 — CID 121013199
2-[methyl-[3-(methylcarbamoyl)-5-nitrobenzoyl]amino]acetic acid (PubChem CID 121013199) has the molecular formula C12H13N3O6 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-[methyl-[3-(methylcarbamoyl)-5-nitrobenzoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-(methylcarbamoyl)-5-nitrobenzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 121013199 |
| Molecular Formula | C12H13N3O6 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[methyl-[3-(methylcarbamoyl)-5-nitrobenzoyl]amino]acetic acid |
| SMILES | CNC(=O)c1cc(C(=O)N(C)CC(=O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O6/c1-13-11(18)7-3-8(5-9(4-7)15(20)21)12(19)14(2)6-10(16)17/h3-5H,6H2,1-2H3,(H,13,18)(H,16,17) |
| InChIKey | NTSSMLFZJQGNAB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|