C9H10N2O4 — CID 124705788
3-hydroxy-N,N-dimethyl-5-nitrobenzamide (PubChem CID 124705788) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethyl-5-nitrobenzamide.
| Compound Name | 3-hydroxy-N,N-dimethyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 124705788 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-hydroxy-N,N-dimethyl-5-nitrobenzamide |
| SMILES | CN(C)C(=O)c1cc(O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N2O4/c1-10(2)9(13)6-3-7(11(14)15)5-8(12)4-6/h3-5,12H,1-2H3 |
| InChIKey | BMHPHGHLBLKFBI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|