C9H9N3O6 — CID 3428904
2-hydroxy-N,N-dimethyl-3,5-dinitrobenzamide (PubChem CID 3428904) has the molecular formula C9H9N3O6 and a molecular weight of 255.19 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3,5-dinitrobenzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3428904 |
| Molecular Formula | C9H9N3O6 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3,5-dinitrobenzamide |
| SMILES | CN(C)C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C9H9N3O6/c1-10(2)9(14)6-3-5(11(15)16)4-7(8(6)13)12(17)18/h3-4,13H,1-2H3 |
| InChIKey | RBTUGYIQIDQCKV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|