C6H8AlN3O8 — CID 173341136
alumane;2,4,6-trinitrophenol;hydrate (PubChem CID 173341136) has the molecular formula C6H8AlN3O8 and a molecular weight of 277.12 g/mol. Its IUPAC name is alumane;2,4,6-trinitrophenol;hydrate.
| Compound Name | alumane;2,4,6-trinitrophenol;hydrate |
|---|---|
| PubChem CID | 173341136 |
| Molecular Formula | C6H8AlN3O8 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | alumane;2,4,6-trinitrophenol;hydrate |
| SMILES | O.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.[AlH3] |
| InChI | InChI=1S/C6H3N3O7.Al.H2O.3H/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;;;;;/h1-2,10H;;1H2;;; |
| InChIKey | OROKXVBRZUCYDW-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 181.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|