C19H29N5O7 — CID 71337810
1,8-diazabicyclo[6.4.3]pentadecane;2,4,6-trinitrophenol (PubChem CID 71337810) has the molecular formula C19H29N5O7 and a molecular weight of 439.47 g/mol. Its IUPAC name is 1,8-diazabicyclo[6.4.3]pentadecane;2,4,6-trinitrophenol.
| Compound Name | 1,8-diazabicyclo[6.4.3]pentadecane;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71337810 |
| Molecular Formula | C19H29N5O7 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 1,8-diazabicyclo[6.4.3]pentadecane;2,4,6-trinitrophenol |
| SMILES | C1CCCN2CCCCN(CC1)CCC2.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H26N2.C6H3N3O7/c1-2-4-9-15-11-6-5-10-14(8-3-1)12-7-13-15;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-13H2;1-2,10H |
| InChIKey | AETRBFPZCWVJDR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 156.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|