C17H22N4O7 — CID 71299516
(1R,4R)-8-azatricyclo[6.3.1.04,12]dodecane;2,4,6-trinitrophenol (PubChem CID 71299516) has the molecular formula C17H22N4O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is (1R,4R)-8-azatricyclo[6.3.1.04,12]dodecane;2,4,6-trinitrophenol.
| Compound Name | (1R,4R)-8-azatricyclo[6.3.1.04,12]dodecane;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 71299516 |
| Molecular Formula | C17H22N4O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (1R,4R)-8-azatricyclo[6.3.1.04,12]dodecane;2,4,6-trinitrophenol |
| SMILES | C1C[C@H]2CC[C@@H]3CCCN(C1)C23.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H19N.C6H3N3O7/c1-3-9-5-6-10-4-2-8-12(7-1)11(9)10;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h9-11H,1-8H2;1-2,10H/t9-,10-;/m0./s1 |
| InChIKey | HYIQHNCUBKQACW-IYPAPVHQSA-N |
| XLogP | 3.39 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|