C17H24N4O7 — CID 72942902
1-cyclohexylpiperidine;2,4,6-trinitrophenol (PubChem CID 72942902) has the molecular formula C17H24N4O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is 1-cyclohexylpiperidine;2,4,6-trinitrophenol.
| Compound Name | 1-cyclohexylpiperidine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 72942902 |
| Molecular Formula | C17H24N4O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-cyclohexylpiperidine;2,4,6-trinitrophenol |
| SMILES | C1CCC(N2CCCCC2)CC1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H21N.C6H3N3O7/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h11H,1-10H2;1-2,10H |
| InChIKey | RWHBFQRWUAXBMR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|