C22H21N3O7 — CID 44721829
1-cyclohexylnaphthalene;2,4,6-trinitrophenol (PubChem CID 44721829) has the molecular formula C22H21N3O7 and a molecular weight of 439.42 g/mol. Its IUPAC name is 1-cyclohexylnaphthalene;2,4,6-trinitrophenol.
| Compound Name | 1-cyclohexylnaphthalene;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 44721829 |
| Molecular Formula | C22H21N3O7 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 1-cyclohexylnaphthalene;2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.c1ccc2c(C3CCCCC3)cccc2c1 |
| InChI | InChI=1S/C16H18.C6H3N3O7/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h4-6,9-13H,1-3,7-8H2;1-2,10H |
| InChIKey | XVHUUHMXLNYKEG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|