About 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol
2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol (PubChem CID 159298843) has the molecular formula C24H31NO4
and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol.
Molecular Properties
| Compound Name | 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol |
| PubChem CID | 159298843 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol |
| SMILES | O=[N+]([O-])c1cccc(C2CCCCC2)c1O.Oc1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C12H15NO3.C12H16O/c14-12-10(9-5-2-1-3-6-9)7-4-8-11(12)13(15)16;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4,7-9,14H,1-3,5-6H2;4-5,8-10,13H,1-3,6-7H2 |
| InChIKey | LBBMQOSIUPVKHB-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol?
The IUPAC name of 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol (CID 159298843) is 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol.
What is the SMILES notation for 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol?
The canonical SMILES for 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol is O=[N+]([O-])c1cccc(C2CCCCC2)c1O.Oc1ccccc1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol?
The InChIKey is LBBMQOSIUPVKHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3.C12H16O/c14-12-10(9-5-2-1-3-6-9)7-4-8-11(12)13(15)16;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4,7-9,14H,1-3,5-6H2;4-5,8-10,13H,1-3,6-7H2.
What are the key properties of 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol?
2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol has a molecular weight of 397.52 g/mol, XLogP of 6.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-6-nitrophenol;2-cyclohexylphenol is sourced from PubChem (CID 159298843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).