C12H14O2 — CID 146178995
3-cyclopentyl-2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 146178995) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-cyclopentyl-2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 3-cyclopentyl-2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 146178995 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-cyclopentyl-2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1ccccc(C2CCCC2)c1O |
| InChI | InChI=1S/C12H14O2/c13-11-8-4-3-7-10(12(11)14)9-5-1-2-6-9/h3-4,7-9H,1-2,5-6H2,(H,13,14) |
| InChIKey | OIOAXJOHERIPET-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |