About 2-cyclododecylphenol
2-cyclododecylphenol (PubChem CID 22381643) has the molecular formula C18H28O
and a molecular weight of 260.42 g/mol. Its IUPAC name is 2-cyclododecylphenol.
Molecular Properties
| Compound Name | 2-cyclododecylphenol |
| PubChem CID | 22381643 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 2-cyclododecylphenol |
| SMILES | Oc1ccccc1C1CCCCCCCCCCC1 |
| InChI | InChI=1S/C18H28O/c19-18-15-11-10-14-17(18)16-12-8-6-4-2-1-3-5-7-9-13-16/h10-11,14-16,19H,1-9,12-13H2 |
| InChIKey | IHRMORKSPQLLPZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclododecylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclododecylphenol?
The IUPAC name of 2-cyclododecylphenol (CID 22381643) is 2-cyclododecylphenol.
What is the SMILES notation for 2-cyclododecylphenol?
The canonical SMILES for 2-cyclododecylphenol is Oc1ccccc1C1CCCCCCCCCCC1.
What is the InChIKey of 2-cyclododecylphenol?
The InChIKey is IHRMORKSPQLLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O/c19-18-15-11-10-14-17(18)16-12-8-6-4-2-1-3-5-7-9-13-16/h10-11,14-16,19H,1-9,12-13H2.
What are the key properties of 2-cyclododecylphenol?
2-cyclododecylphenol has a molecular weight of 260.42 g/mol, XLogP of 5.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclododecylphenol is sourced from PubChem (CID 22381643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).