C12H14O — CID 157060822
2-cyclobutyl-7-methylcyclohepta-2,4,6-trien-1-one (PubChem CID 157060822) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-cyclobutyl-7-methylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-cyclobutyl-7-methylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 157060822 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 2-cyclobutyl-7-methylcyclohepta-2,4,6-trien-1-one |
| SMILES | Cc1ccccc(C2CCC2)c1=O |
| InChI | InChI=1S/C12H14O/c1-9-5-2-3-8-11(12(9)13)10-6-4-7-10/h2-3,5,8,10H,4,6-7H2,1H3 |
| InChIKey | QBACXOLSKXXSQH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |