C18H28 — CID 21161883
(2,3-dimethylphenyl)cyclodecane (PubChem CID 21161883) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is (2,3-dimethylphenyl)cyclodecane.
| Compound Name | (2,3-dimethylphenyl)cyclodecane |
|---|---|
| PubChem CID | 21161883 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (2,3-dimethylphenyl)cyclodecane |
| SMILES | Cc1cccc(C2CCCCCCCCC2)c1C |
| InChI | InChI=1S/C18H28/c1-15-11-10-14-18(16(15)2)17-12-8-6-4-3-5-7-9-13-17/h10-11,14,17H,3-9,12-13H2,1-2H3 |
| InChIKey | QHTOQTATYITYFY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |