About CID 174102953
CID 174102953 (PubChem CID 174102953) has the molecular formula C20H29B
and a molecular weight of 280.26 g/mol.
Molecular Properties
| Compound Name | CID 174102953 |
| PubChem CID | 174102953 |
| Molecular Formula | C20H29B |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | — |
| SMILES | [B]C1CCC(C2CCC(c3cccc(C)c3C)CC2)CC1 |
| InChI | InChI=1S/C20H29B/c1-14-4-3-5-20(15(14)2)18-8-6-16(7-9-18)17-10-12-19(21)13-11-17/h3-5,16-19H,6-13H2,1-2H3 |
| InChIKey | FDXXUQYNFOQNCU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174102953 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174102953?
The IUPAC name of CID 174102953 (CID 174102953) is not available.
What is the SMILES notation for CID 174102953?
The canonical SMILES for CID 174102953 is [B]C1CCC(C2CCC(c3cccc(C)c3C)CC2)CC1.
What is the InChIKey of CID 174102953?
The InChIKey is FDXXUQYNFOQNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29B/c1-14-4-3-5-20(15(14)2)18-8-6-16(7-9-18)17-10-12-19(21)13-11-17/h3-5,16-19H,6-13H2,1-2H3.
What are the key properties of CID 174102953?
CID 174102953 has a molecular weight of 280.26 g/mol, XLogP of 5.72, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174102953 is sourced from PubChem (CID 174102953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).