About 1-cyclopropyl-2-iodo-3,4-dimethylbenzene
1-cyclopropyl-2-iodo-3,4-dimethylbenzene (PubChem CID 170981929) has the molecular formula C11H13I
and a molecular weight of 272.13 g/mol. Its IUPAC name is 1-cyclopropyl-2-iodo-3,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-iodo-3,4-dimethylbenzene |
| PubChem CID | 170981929 |
| Molecular Formula | C11H13I |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 1-cyclopropyl-2-iodo-3,4-dimethylbenzene |
| SMILES | Cc1ccc(C2CC2)c(I)c1C |
| InChI | InChI=1S/C11H13I/c1-7-3-6-10(9-4-5-9)11(12)8(7)2/h3,6,9H,4-5H2,1-2H3 |
| InChIKey | GXEQKPIUFGNBQQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-2-iodo-3,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-iodo-3,4-dimethylbenzene?
The IUPAC name of 1-cyclopropyl-2-iodo-3,4-dimethylbenzene (CID 170981929) is 1-cyclopropyl-2-iodo-3,4-dimethylbenzene.
What is the SMILES notation for 1-cyclopropyl-2-iodo-3,4-dimethylbenzene?
The canonical SMILES for 1-cyclopropyl-2-iodo-3,4-dimethylbenzene is Cc1ccc(C2CC2)c(I)c1C.
What is the InChIKey of 1-cyclopropyl-2-iodo-3,4-dimethylbenzene?
The InChIKey is GXEQKPIUFGNBQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13I/c1-7-3-6-10(9-4-5-9)11(12)8(7)2/h3,6,9H,4-5H2,1-2H3.
What are the key properties of 1-cyclopropyl-2-iodo-3,4-dimethylbenzene?
1-cyclopropyl-2-iodo-3,4-dimethylbenzene has a molecular weight of 272.13 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-iodo-3,4-dimethylbenzene is sourced from PubChem (CID 170981929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).