About 1,2,3,4-tetramethylbenzene
1,2,3,4-tetramethylbenzene (PubChem CID 10263) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 1,2,3,4-tetramethylbenzene.
Molecular Properties
| Compound Name | 1,2,3,4-tetramethylbenzene |
| PubChem CID | 10263 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 1,2,3,4-tetramethylbenzene |
| SMILES | Cc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3 |
| InChIKey | UOHMMEJUHBCKEE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,3,4-tetramethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetramethylbenzene?
The IUPAC name of 1,2,3,4-tetramethylbenzene (CID 10263) is 1,2,3,4-tetramethylbenzene.
What is the SMILES notation for 1,2,3,4-tetramethylbenzene?
The canonical SMILES for 1,2,3,4-tetramethylbenzene is Cc1ccc(C)c(C)c1C.
What is the InChIKey of 1,2,3,4-tetramethylbenzene?
The InChIKey is UOHMMEJUHBCKEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-7-5-6-8(2)10(4)9(7)3/h5-6H,1-4H3.
What are the key properties of 1,2,3,4-tetramethylbenzene?
1,2,3,4-tetramethylbenzene has a molecular weight of 134.22 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetramethylbenzene is sourced from PubChem (CID 10263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).