C16H20F2 — CID 158288889
1-(4-cyclopropylcyclohexyl)-2,3-difluoro-4-methylbenzene (PubChem CID 158288889) has the molecular formula C16H20F2 and a molecular weight of 250.33 g/mol. Its IUPAC name is 1-(4-cyclopropylcyclohexyl)-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-(4-cyclopropylcyclohexyl)-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 158288889 |
| Molecular Formula | C16H20F2 |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-(4-cyclopropylcyclohexyl)-2,3-difluoro-4-methylbenzene |
| SMILES | Cc1ccc(C2CCC(C3CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C16H20F2/c1-10-2-9-14(16(18)15(10)17)13-7-5-12(6-8-13)11-3-4-11/h2,9,11-13H,3-8H2,1H3 |
| InChIKey | WQBFGFGTLHVIDR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |