C19H27ClFN — CID 130252791
4-[4-(3-chloro-2-fluoro-4-methylphenyl)cyclohexyl]cyclohexan-1-amine (PubChem CID 130252791) has the molecular formula C19H27ClFN and a molecular weight of 323.88 g/mol. Its IUPAC name is 4-[4-(3-chloro-2-fluoro-4-methylphenyl)cyclohexyl]cyclohexan-1-amine.
| Compound Name | 4-[4-(3-chloro-2-fluoro-4-methylphenyl)cyclohexyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 130252791 |
| Molecular Formula | C19H27ClFN |
| Molecular Weight | 323.88 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-[4-(3-chloro-2-fluoro-4-methylphenyl)cyclohexyl]cyclohexan-1-amine |
| SMILES | Cc1ccc(C2CCC(C3CCC(N)CC3)CC2)c(F)c1Cl |
| InChI | InChI=1S/C19H27ClFN/c1-12-2-11-17(19(21)18(12)20)15-5-3-13(4-6-15)14-7-9-16(22)10-8-14/h2,11,13-16H,3-10,22H2,1H3 |
| InChIKey | FBLDUJGSNCZTSR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |