C22H29F2Re- — CID 173489359
2,3-difluoro-1-methyl-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]benzene;rhenium (PubChem CID 173489359) has the molecular formula C22H29F2Re- and a molecular weight of 517.68 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]benzene;rhenium.
| Compound Name | 2,3-difluoro-1-methyl-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]benzene;rhenium |
|---|---|
| PubChem CID | 173489359 |
| Molecular Formula | C22H29F2Re- |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[4-(4-prop-2-enylcyclohexyl)cyclohexyl]benzene;rhenium |
| SMILES | [H]/[C-]=C\CC1CCC(C2CCC(c3ccc(C)c(F)c3F)CC2)CC1.[Re] |
| InChI | InChI=1S/C22H29F2.Re/c1-3-4-16-6-8-17(9-7-16)18-10-12-19(13-11-18)20-14-5-15(2)21(23)22(20)24;/h1,3,5,14,16-19H,4,6-13H2,2H3;/q-1; |
| InChIKey | HOPUQXJGNYADMC-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|