C14H22O2 — CID 144560479
1-cyclopropyl-2,3-dimethylbenzene;ethane;formic acid (PubChem CID 144560479) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-cyclopropyl-2,3-dimethylbenzene;ethane;formic acid.
| Compound Name | 1-cyclopropyl-2,3-dimethylbenzene;ethane;formic acid |
|---|---|
| PubChem CID | 144560479 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-cyclopropyl-2,3-dimethylbenzene;ethane;formic acid |
| SMILES | CC.Cc1cccc(C2CC2)c1C.O=CO |
| InChI | InChI=1S/C11H14.C2H6.CH2O2/c1-8-4-3-5-11(9(8)2)10-6-7-10;1-2;2-1-3/h3-5,10H,6-7H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | PRPBGCXDXLISCP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|