About formic acid;1,2-xylene
formic acid;1,2-xylene (PubChem CID 175948526) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is formic acid;1,2-xylene.
Molecular Properties
| Compound Name | formic acid;1,2-xylene |
| PubChem CID | 175948526 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | formic acid;1,2-xylene |
| SMILES | Cc1ccccc1C.O=CO.O=CO |
| InChI | InChI=1S/C8H10.2CH2O2/c1-7-5-3-4-6-8(7)2;2*2-1-3/h3-6H,1-2H3;2*1H,(H,2,3) |
| InChIKey | GARDCMFCNXVDAP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;1,2-xylene?
The IUPAC name of formic acid;1,2-xylene (CID 175948526) is formic acid;1,2-xylene.
What is the SMILES notation for formic acid;1,2-xylene?
The canonical SMILES for formic acid;1,2-xylene is Cc1ccccc1C.O=CO.O=CO.
What is the InChIKey of formic acid;1,2-xylene?
The InChIKey is GARDCMFCNXVDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.2CH2O2/c1-7-5-3-4-6-8(7)2;2*2-1-3/h3-6H,1-2H3;2*1H,(H,2,3).
What are the key properties of formic acid;1,2-xylene?
formic acid;1,2-xylene has a molecular weight of 198.22 g/mol, XLogP of 1.71, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;1,2-xylene is sourced from PubChem (CID 175948526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).