C16H22O4S — CID 174805286
sulfuric acid;bis(1,2-xylene) (PubChem CID 174805286) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is sulfuric acid;bis(1,2-xylene).
| Compound Name | sulfuric acid;bis(1,2-xylene) |
|---|---|
| PubChem CID | 174805286 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | sulfuric acid;bis(1,2-xylene) |
| SMILES | Cc1ccccc1C.Cc1ccccc1C.O=S(=O)(O)O |
| InChI | InChI=1S/2C8H10.H2O4S/c2*1-7-5-3-4-6-8(7)2;1-5(2,3)4/h2*3-6H,1-2H3;(H2,1,2,3,4) |
| InChIKey | IZCXSBMMKPNVJM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|