C8H12O5S — CID 70184177
2,3-dimethylphenol;sulfuric acid (PubChem CID 70184177) has the molecular formula C8H12O5S and a molecular weight of 220.25 g/mol. Its IUPAC name is 2,3-dimethylphenol;sulfuric acid.
| Compound Name | 2,3-dimethylphenol;sulfuric acid |
|---|---|
| PubChem CID | 70184177 |
| Molecular Formula | C8H12O5S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2,3-dimethylphenol;sulfuric acid |
| SMILES | Cc1cccc(O)c1C.O=S(=O)(O)O |
| InChI | InChI=1S/C8H10O.H2O4S/c1-6-4-3-5-8(9)7(6)2;1-5(2,3)4/h3-5,9H,1-2H3;(H2,1,2,3,4) |
| InChIKey | SZMOZJVNTVWYEG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|