C16H20O2 — CID 67827029
2,3-dimethylphenol;2,4-dimethylphenol (PubChem CID 67827029) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2,3-dimethylphenol;2,4-dimethylphenol.
| Compound Name | 2,3-dimethylphenol;2,4-dimethylphenol |
|---|---|
| PubChem CID | 67827029 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2,3-dimethylphenol;2,4-dimethylphenol |
| SMILES | Cc1ccc(O)c(C)c1.Cc1cccc(O)c1C |
| InChI | InChI=1S/2C8H10O/c1-6-3-4-8(9)7(2)5-6;1-6-4-3-5-8(9)7(6)2/h2*3-5,9H,1-2H3 |
| InChIKey | AVGPBFMPXAHVFH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |