About CID 175892141
CID 175892141 (PubChem CID 175892141) has the molecular formula C8H10AlO
and a molecular weight of 149.15 g/mol.
Molecular Properties
| Compound Name | CID 175892141 |
| PubChem CID | 175892141 |
| Molecular Formula | C8H10AlO |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | — |
| SMILES | Cc1ccc(O)c(C)c1.[Al] |
| InChI | InChI=1S/C8H10O.Al/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1-2H3; |
| InChIKey | XLYNHISLMFGXNS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 175892141 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175892141?
The IUPAC name of CID 175892141 (CID 175892141) is not available.
What is the SMILES notation for CID 175892141?
The canonical SMILES for CID 175892141 is Cc1ccc(O)c(C)c1.[Al].
What is the InChIKey of CID 175892141?
The InChIKey is XLYNHISLMFGXNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.Al/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1-2H3;.
What are the key properties of CID 175892141?
CID 175892141 has a molecular weight of 149.15 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175892141 is sourced from PubChem (CID 175892141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).