About CID 172763014
CID 172763014 (PubChem CID 172763014) has the molecular formula C8H10LiO
and a molecular weight of 129.11 g/mol.
Molecular Properties
| Compound Name | CID 172763014 |
| PubChem CID | 172763014 |
| Molecular Formula | C8H10LiO |
| Molecular Weight | 129.11 g/mol |
| Exact Mass | 129.09 |
| IUPAC Name | — |
| SMILES | Cc1ccc(O)c(C)c1.[Li] |
| InChI | InChI=1S/C8H10O.Li/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1-2H3; |
| InChIKey | LYEDGKPMDYUPDP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.11 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 172763014 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172763014?
The IUPAC name of CID 172763014 (CID 172763014) is not available.
What is the SMILES notation for CID 172763014?
The canonical SMILES for CID 172763014 is Cc1ccc(O)c(C)c1.[Li].
What is the InChIKey of CID 172763014?
The InChIKey is LYEDGKPMDYUPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.Li/c1-6-3-4-8(9)7(2)5-6;/h3-5,9H,1-2H3;.
What are the key properties of CID 172763014?
CID 172763014 has a molecular weight of 129.11 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172763014 is sourced from PubChem (CID 172763014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).