C18H34O — CID 143520980
butane;2,4-dimethylphenol;2-methylpentane (PubChem CID 143520980) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is butane;2,4-dimethylphenol;2-methylpentane.
| Compound Name | butane;2,4-dimethylphenol;2-methylpentane |
|---|---|
| PubChem CID | 143520980 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | butane;2,4-dimethylphenol;2-methylpentane |
| SMILES | CCCC.CCCC(C)C.Cc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C8H10O.C6H14.C4H10/c1-6-3-4-8(9)7(2)5-6;1-4-5-6(2)3;1-3-4-2/h3-5,9H,1-2H3;6H,4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | JPOXFOXFTVETKS-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |