C17H24O2 — CID 162172477
2,4-dimethylphenol;2,6-dimethylphenol;methane (PubChem CID 162172477) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2,4-dimethylphenol;2,6-dimethylphenol;methane.
| Compound Name | 2,4-dimethylphenol;2,6-dimethylphenol;methane |
|---|---|
| PubChem CID | 162172477 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2,4-dimethylphenol;2,6-dimethylphenol;methane |
| SMILES | C.Cc1ccc(O)c(C)c1.Cc1cccc(C)c1O |
| InChI | InChI=1S/2C8H10O.CH4/c1-6-3-4-8(9)7(2)5-6;1-6-4-3-5-7(2)8(6)9;/h2*3-5,9H,1-2H3;1H4 |
| InChIKey | ZNYXTOAGKYFKPL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |