C17H22O2 — CID 69435633
2,6-dimethylphenol;2,3,5-trimethylphenol (PubChem CID 69435633) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2,6-dimethylphenol;2,3,5-trimethylphenol.
| Compound Name | 2,6-dimethylphenol;2,3,5-trimethylphenol |
|---|---|
| PubChem CID | 69435633 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2,6-dimethylphenol;2,3,5-trimethylphenol |
| SMILES | Cc1cc(C)c(C)c(O)c1.Cc1cccc(C)c1O |
| InChI | InChI=1S/C9H12O.C8H10O/c1-6-4-7(2)8(3)9(10)5-6;1-6-4-3-5-7(2)8(6)9/h4-5,10H,1-3H3;3-5,9H,1-2H3 |
| InChIKey | AIXLQDLKJLOUMX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |