C11H15NO2 — CID 175431891
methylimino(oxo)methane;2,3,5-trimethylphenol (PubChem CID 175431891) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is methylimino(oxo)methane;2,3,5-trimethylphenol.
| Compound Name | methylimino(oxo)methane;2,3,5-trimethylphenol |
|---|---|
| PubChem CID | 175431891 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | methylimino(oxo)methane;2,3,5-trimethylphenol |
| SMILES | CN=C=O.Cc1cc(C)c(C)c(O)c1 |
| InChI | InChI=1S/C9H12O.C2H3NO/c1-6-4-7(2)8(3)9(10)5-6;1-3-2-4/h4-5,10H,1-3H3;1H3 |
| InChIKey | UVGLXTLOVSLVAT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|