C20H24O4 — CID 139057763
1-(2-hydroxy-4,6-dimethylphenyl)ethanone (PubChem CID 139057763) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-(2-hydroxy-4,6-dimethylphenyl)ethanone.
| Compound Name | 1-(2-hydroxy-4,6-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 139057763 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethylphenyl)ethanone |
| SMILES | CC(=O)c1c(C)cc(C)cc1O.CC(=O)c1c(C)cc(C)cc1O |
| InChI | InChI=1S/2C10H12O2/c2*1-6-4-7(2)10(8(3)11)9(12)5-6/h2*4-5,12H,1-3H3 |
| InChIKey | TXKVBBPDWGUARD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |