C15H20O3 — CID 167607285
1-(2-hydroxy-4,6-dimethylphenyl)-4,4-dimethylpentane-1,3-dione (PubChem CID 167607285) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-(2-hydroxy-4,6-dimethylphenyl)-4,4-dimethylpentane-1,3-dione.
| Compound Name | 1-(2-hydroxy-4,6-dimethylphenyl)-4,4-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 167607285 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethylphenyl)-4,4-dimethylpentane-1,3-dione |
| SMILES | Cc1cc(C)c(C(=O)CC(=O)C(C)(C)C)c(O)c1 |
| InChI | InChI=1S/C15H20O3/c1-9-6-10(2)14(11(16)7-9)12(17)8-13(18)15(3,4)5/h6-7,16H,8H2,1-5H3 |
| InChIKey | WGTSCYHHJCOYHL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|