C15H22O2S — CID 64639679
2-tert-butylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 64639679) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-tert-butylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-tert-butylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 64639679 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-tert-butylsulfinyl-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CS(=O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C15H22O2S/c1-10-7-11(2)14(12(3)8-10)13(16)9-18(17)15(4,5)6/h7-8H,9H2,1-6H3 |
| InChIKey | WTZOCOWTMJDHPF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |