C14H20O2S — CID 64639475
2-tert-butylsulfinyl-1-(2,4-dimethylphenyl)ethanone (PubChem CID 64639475) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-tert-butylsulfinyl-1-(2,4-dimethylphenyl)ethanone.
| Compound Name | 2-tert-butylsulfinyl-1-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 64639475 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-tert-butylsulfinyl-1-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C(=O)CS(=O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H20O2S/c1-10-6-7-12(11(2)8-10)13(15)9-17(16)14(3,4)5/h6-8H,9H2,1-5H3 |
| InChIKey | WMUWEQLJZXYKNR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |