C16H23NO2 — CID 94273837
N-tert-butyl-4-(2,4-dimethylphenyl)-4-oxobutanamide (PubChem CID 94273837) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-tert-butyl-4-(2,4-dimethylphenyl)-4-oxobutanamide.
| Compound Name | N-tert-butyl-4-(2,4-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 94273837 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-tert-butyl-4-(2,4-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C16H23NO2/c1-11-6-7-13(12(2)10-11)14(18)8-9-15(19)17-16(3,4)5/h6-7,10H,8-9H2,1-5H3,(H,17,19) |
| InChIKey | KZTUHRCVRMPEGY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |