C17H25N3O2S — CID 9425632
1-tert-butyl-3-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]thiourea (PubChem CID 9425632) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]thiourea |
|---|---|
| PubChem CID | 9425632 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-tert-butyl-3-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]thiourea |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)NNC(=S)NC(C)(C)C)c1 |
| InChI | InChI=1S/C17H25N3O2S/c1-11-6-7-12(2)13(10-11)14(21)8-9-15(22)19-20-16(23)18-17(3,4)5/h6-7,10H,8-9H2,1-5H3,(H,19,22)(H2,18,20,23) |
| InChIKey | RMZAGVKVOWVIDS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|