C16H21NO4 — CID 120687054
2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid (PubChem CID 120687054) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120687054 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)CCC(=O)c1cc(C)ccc1C)C(=O)O |
| InChI | InChI=1S/C16H21NO4/c1-4-13(16(20)21)17-15(19)8-7-14(18)12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | OJKVSJDAFYTXCF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |