2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid

C16H21NO4 — CID 120687054

IUPAC2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid
SMILESCCC(NC(=O)CCC(=O)c1cc(C)ccc1C)C(=O)O
InChIInChI=1S/C16H21NO4/c1-4-13(16(20)21)17-15(19)8-7-14(18)12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3,(H,17,19)(H,20,21)
InChIKeyOJKVSJDAFYTXCF-UHFFFAOYSA-N
MW291.35 g/mol
LogP2.25
Rot. Bonds7

About 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid

2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid (PubChem CID 120687054) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid.

Molecular Properties

Compound Name2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid
PubChem CID120687054
Molecular FormulaC16H21NO4
Molecular Weight291.35 g/mol
Exact Mass291.15
IUPAC Name2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid
SMILESCCC(NC(=O)CCC(=O)c1cc(C)ccc1C)C(=O)O
InChIInChI=1S/C16H21NO4/c1-4-13(16(20)21)17-15(19)8-7-14(18)12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3,(H,17,19)(H,20,21)
InChIKeyOJKVSJDAFYTXCF-UHFFFAOYSA-N
XLogP2.25
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 52.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid?
The IUPAC name of 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid (CID 120687054) is 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid.
What is the SMILES notation for 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid?
The canonical SMILES for 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid is CCC(NC(=O)CCC(=O)c1cc(C)ccc1C)C(=O)O.
What is the InChIKey of 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid?
The InChIKey is OJKVSJDAFYTXCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c1-4-13(16(20)21)17-15(19)8-7-14(18)12-9-10(2)5-6-11(12)3/h5-6,9,13H,4,7-8H2,1-3H3,(H,17,19)(H,20,21).
What are the key properties of 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid?
2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid has a molecular weight of 291.35 g/mol, XLogP of 2.25, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]butanoic acid is sourced from PubChem (CID 120687054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).