C20H22N2O3 — CID 51315387
N-(2-amino-2-oxo-1-phenylethyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide (PubChem CID 51315387) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-(2-amino-2-oxo-1-phenylethyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide.
| Compound Name | N-(2-amino-2-oxo-1-phenylethyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 51315387 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-(2-amino-2-oxo-1-phenylethyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)NC(C(N)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-13-8-9-14(2)16(12-13)17(23)10-11-18(24)22-19(20(21)25)15-6-4-3-5-7-15/h3-9,12,19H,10-11H2,1-2H3,(H2,21,25)(H,22,24) |
| InChIKey | SXTMLLTWMIRJIQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |