C17H23NO4 — CID 120689364
4-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]pentanoic acid (PubChem CID 120689364) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 4-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]pentanoic acid.
| Compound Name | 4-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120689364 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-[[4-(2,5-dimethylphenyl)-4-oxobutanoyl]amino]pentanoic acid |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)NC(C)CCC(=O)O)c1 |
| InChI | InChI=1S/C17H23NO4/c1-11-4-5-12(2)14(10-11)15(19)7-8-16(20)18-13(3)6-9-17(21)22/h4-5,10,13H,6-9H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | MYEPICAHNYBCJD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |