5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid

C15H21NO3 — CID 82009424

IUPAC5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid
SMILESCc1ccc(C)c(C(=O)NCC(C)CCC(=O)O)c1
InChIInChI=1S/C15H21NO3/c1-10-4-6-12(3)13(8-10)15(19)16-9-11(2)5-7-14(17)18/h4,6,8,11H,5,7,9H2,1-3H3,(H,16,19)(H,17,18)
InChIKeySFQSKBBSOUPSCJ-UHFFFAOYSA-N
MW263.34 g/mol
LogP2.53
Rot. Bonds6

About 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid

5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid (PubChem CID 82009424) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid.

Molecular Properties

Compound Name5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid
PubChem CID82009424
Molecular FormulaC15H21NO3
Molecular Weight263.34 g/mol
Exact Mass263.15
IUPAC Name5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid
SMILESCc1ccc(C)c(C(=O)NCC(C)CCC(=O)O)c1
InChIInChI=1S/C15H21NO3/c1-10-4-6-12(3)13(8-10)15(19)16-9-11(2)5-7-14(17)18/h4,6,8,11H,5,7,9H2,1-3H3,(H,16,19)(H,17,18)
InChIKeySFQSKBBSOUPSCJ-UHFFFAOYSA-N
XLogP2.53
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.34
LogP ≤ 52.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid?
The IUPAC name of 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid (CID 82009424) is 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid.
What is the SMILES notation for 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid?
The canonical SMILES for 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid is Cc1ccc(C)c(C(=O)NCC(C)CCC(=O)O)c1.
What is the InChIKey of 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid?
The InChIKey is SFQSKBBSOUPSCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-10-4-6-12(3)13(8-10)15(19)16-9-11(2)5-7-14(17)18/h4,6,8,11H,5,7,9H2,1-3H3,(H,16,19)(H,17,18).
What are the key properties of 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid?
5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid has a molecular weight of 263.34 g/mol, XLogP of 2.53, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dimethylbenzoyl)amino]-4-methylpentanoic acid is sourced from PubChem (CID 82009424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).