C16H23NO3 — CID 111428870
4-(2,5-dimethylphenyl)-N-(3-hydroxybutyl)-4-oxobutanamide (PubChem CID 111428870) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-N-(3-hydroxybutyl)-4-oxobutanamide.
| Compound Name | 4-(2,5-dimethylphenyl)-N-(3-hydroxybutyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 111428870 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-N-(3-hydroxybutyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)NCCC(C)O)c1 |
| InChI | InChI=1S/C16H23NO3/c1-11-4-5-12(2)14(10-11)15(19)6-7-16(20)17-9-8-13(3)18/h4-5,10,13,18H,6-9H2,1-3H3,(H,17,20) |
| InChIKey | BLPDVOCUEYFSFM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |